| Identification | |
| Name: | 2-Pyridineethanol,5-ethyl- |
| Synonyms: | 2-(5-Ethyl-2-pyridinyl)ethanol;2-(5-Ethyl-2-pyridyl)ethanol;2-(5-Ethylpyridin-2-yl)ethanol;5-Ethyl-2-(2-hydroxyethyl)pyridine;5-Ethyl-2-(b-hydroxyethyl)pyridine; |
| CAS: | 5223-06-3 |
| EINECS: | 226-024-3 |
| Molecular Formula: | C9H13 N O |
| Molecular Weight: | 151.21 |
| InChI: | InChI=1/C9H13NO/c1-2-8-3-4-9(5-6-11)10-7-8/h3-4,7,11H,2,5-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.037 g/cm3 |
| Appearance: | white needles |
| Specification: | White to Straw Yellow Crystals usageEng:2-(5-Ethyl-2-pyridyl)ethanol is used as building block in chemical synthesis. Product Data Sheet Safety Statements:26-36/37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Usage: | 2-(5-Ethyl-2-pyridyl)ethanol is used as building block in chemical synthesis. Product Data Sheet |
| Safety Data | |
 |
|
