| Identification | |
| Name: | 1,4-Benzodioxin,6-bromo-2,3-dihydro- |
| Synonyms: | 3,4-Ethylenedioxybromobenzene;4-Bromo-1,2-ethylenedioxybenzene;6-Bromo-2,3-dihydro-1,4-benzodioxin; |
| CAS: | 52287-51-1 |
| EINECS: | 257-817-2 |
| Molecular Formula: | C8H7BrO2 |
| Molecular Weight: | 215.04 |
| InChI: | InChI=1/C8H7BrO2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-2,5H,3-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Density: | 62 |
| Refractive index: | n20/D 1.588(lit.) |
| Specification: |
1,4-Benzodioxin,6-bromo-2,3-dihydro- , its cas register number is 52287-51-1. It also can be called 3,4-(Ethylenedioxy)bromobenzene ; 6-Bromo-2,3-dihydro-1,4-benzodioxin . 1,4-Benzodioxin,6-bromo-2,3-dihydro- (CAS NO.52287-51-1) is irritating to eyes, respiratory system and skin so that you should wear suitable protective clothing, gloves and eye/face protection. |
| Flash Point: | >230 °F |
| Storage Temperature: | Room temperature. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
