| Identification | |
| Name: | 5-Cyclohexene-1,2,3,4-tetrone,5,6-dihydroxy-, sodium salt (1:2) |
| Synonyms: | 5-Cyclohexene-1,2,3,4-tetrone,5,6-dihydroxy-, disodium salt (8CI,9CI);Rhodizonic acid, disodium deriv.(6CI);Sodium, [(3,4,5,6-tetraoxo-1-cyclohexen-1,2-ylene)dioxy]di- (7CI);Disodium rhodizonate;Sodium,[(3,4,5,6-tetraoxo-1-cyclohexene-1,2-diyl)bis(oxy)]di-; |
| CAS: | 523-21-7 |
| EINECS: | 208-340-3 |
| Molecular Formula: | C6Na2O6 |
| Molecular Weight: | 170.07648 |
| InChI: | InChI=1S/C6H2O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h7-8H |
| Molecular Structure: |  |
| Properties | |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Soluble in water (clear, orange-red solution); slightly soluble in soda solution; insoluble in alcohol |
| Solubility: | Soluble in water (clear, orange-red solution); slightly soluble in soda solution; insoluble in alcohol |
| Appearance: | Dark green powder |
| Specification: | dark green powder Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| HS Code: | 29144090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used as a a reagent for barium and strontium. |
| Safety Data | |
 |
|
