| Identification | |
| Name: | 1,3-Benzodioxole,4,7-dimethoxy-5-(2-propen-1-yl)- |
| Synonyms: | 1,3-Benzodioxole,4,7-dimethoxy-5-(2-propenyl)- (9CI);Apiole (6CI);Benzene,1-allyl-2,5-dimethoxy-3,4-(methylenedioxy)- (7CI,8CI);1,2-Methylenedioxy-3,6-dimethoxy-4-allylbenzene;1-Allyl-2,5-dimethoxy-3,4-methylenedioxybenzene;4,7-Dimethoxy-5-(2-propenyl)-1,3-benzodioxole;5-Allyl-4,7-dimethoxy-1,3-benzodioxole; Apiol;Apioline;NSC 9070;Parsleyapiole;Parsley camphor;Petersilienapiol |
| CAS: | 523-80-8 |
| EINECS: | 208-349-2 |
| Molecular Formula: | C12H14 O4 |
| Molecular Weight: | 222.26 |
| InChI: | InChI=1S/C12H14O4/c1-4-5-8-6-9(13-2)11-12(10(8)14-3)16-7-15-11/h4,6H,1,5,7H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 29°C |
| Flash Point: | 117.2°C |
| Boiling Point: | 294°C |
| Density: | 1.151g/cm3 |
| Refractive index: | 1.53 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 117.2°C |
| Safety Data | |
 |
|
