| Identification | |
| Name: | b-Alanine, N-acetyl-N-butyl-,ethyl ester |
| Synonyms: | 3-[(N-butyl-N-acetyl)amino]propionicacid ethyl ester;AI 3-70763;BAAPE;Ethyl 3-(N-butylacetamido)propionate;IR3535;Merck 3535;Repellent 3535; |
| CAS: | 52304-36-6 |
| EINECS: | 257-835-0 |
| Molecular Formula: | C11H21NO3 |
| Molecular Weight: | 215.29 |
| InChI: | InChI=1/C11H21NO3/c1-4-6-8-12(10(3)13)9-7-11(14)15-5-2/h4-9H2,1-3H3 |
| Molecular Structure: | ![(C11H21NO3) 3-[(N-butyl-N-acetyl)amino]propionicacid ethyl ester;AI 3-70763;BAAPE;Ethyl 3-(N-butylacetamido)prop...](https://img.guidechem.com/casimg/52304-36-6.jpg) |
| Properties | |
| Flash Point: | 144.2°C |
| Boiling Point: | 314.8°Cat760mmHg |
| Density: | 0.987g/cm3 |
| Refractive index: | 1.444 |
| Specification: |
b-Alanine, N-acetyl-N-butyl-,ethyl ester , its cas register number 52304-36-6. It also can be called Ethyl N-acetyl-N-butyl-beta-alaninate ; and Ethyl butylacetylaminopropionate . |
| Flash Point: | 144.2°C |
| Safety Data | |
 |
|
