| Identification | |
| Name: | 3-Cyclobutene-1,2-dione,3,4-diethoxy- |
| Synonyms: | Cyclobutenedione,diethoxy- (7CI,8CI);1,2-Diethoxy-1-cyclobutene-3,4-dione;1,2-Diethoxy-3,4-dioxocyclobut-1-ene;3,4-Diethoxy-3-cyclobutene-1,2-dione;3,4-Diethoxycyclobutene-1,2-dione;Diethoxycyclobutenedione; |
| CAS: | 5231-87-8 |
| Molecular Formula: | C8H10O4 |
| Molecular Weight: | 170.16 |
| InChI: | InChI=1/C8H10O4/c1-3-11-7-5(9)6(10)8(7)12-4-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.15 |
| Refractive index: | 1.508-1.51 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | clear yellow to light brownish liquid |
| Usage: | Intermediate for pharma products, for photochemicals used in the dry-view process, in synthesis of photosensitive squaraine dyes (eg. laser dyes used in CD-Rom) and as intermediate for functional polymers. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
