| Identification | |
| Name: | 3,4-Diaminocyclobut-3-ene-1,2-dione |
| Synonyms: | 3-Cyclobutene-1,2-dione, 3,4-diamino-; |
| CAS: | 5231-89-0 |
| Molecular Formula: | C4H4N2O2 |
| Molecular Weight: | 112.09 |
| InChI: | InChI=1/C4H4N2O2/c5-1-2(6)4(8)3(1)7/h5-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.638g/cm3 |
| Refractive index: | 1.665 |
| Specification: |
The 3,4-Diaminocyclobut-3-ene-1,2-dione, with the CAS registry number 5231-89-0, is also known as 3-Cyclobutene-1,2-dione, 3,4-diamino-. This chemical's molecular formula is C4H4N2O2 and molecular weight is 112.09. Its systematic name is called 3,4-diaminocyclobut-3-ene-1,2-dione. Physical properties of 3,4-Diaminocyclobut-3-ene-1,2-dione: (1)ACD/LogP: -2.57; (2)ACD/LogD (pH 5.5): -2.57; (3)ACD/LogD (pH 7.4): -2.57; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 1; (8)#H bond acceptors: 4; (9)#H bond donors: 4; (10)#Freely Rotating Bonds: 2 ; (11)Index of Refraction: 1.665; (12)Molar Refractivity: 25.4 cm3; (13)Molar Volume: 68.3 cm3; (14)Surface Tension: 89.7 dyne/cm; (15)Density: 1.638 g/cm3; (16)Flash Point: 83.1 °C; (17)Enthalpy of Vaporization: 45.01 kJ/mol; (18)Boiling Point: 213.8 °C at 760 mmHg; (19)Vapour Pressure: 0.161 mmHg at 25°C. Uses of 3,4-Diaminocyclobut-3-ene-1,2-dione: it can be used to produce 3-Amino-4-hydroxy-cyclobut-3-en-1,2-dion. This reaction will need reagent NaOH with reaction time of 3 hours. The yield is about 44%. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
