| Identification | |
| Name: | 2-Pyridinamine,4-ethoxy- |
| Synonyms: | Pyridine,2-amino-4-ethoxy- (6CI,7CI); 2-Amino-4-ethoxypyridine |
| CAS: | 52311-20-3 |
| Molecular Formula: | C7H10 N2 O |
| Molecular Weight: | 138.17 |
| InChI: | InChI=1/C7H10N2O/c1-2-10-6-3-4-9-7(8)5-6/h3-5H,2H2,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 117.4°C |
| Boiling Point: | 270.5°Cat760mmHg |
| Density: | 1.101g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
The extinguishing agent of -Amino-4-ethoxypyridine (CAS No.52311-20-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 117.4°C |
| Safety Data | |
 |
|
