| Identification | |||||||||||||||||||
| Name: | Acetamide,N-(2-acetylphenyl)- | ||||||||||||||||||
| Synonyms: | Acetanilide,2'-acetyl- (6CI,7CI,8CI);2'-(Acetylamino)acetophenone;2'-(N-Acetylamino)acetophenone;2'-Acetamidoacetophenone;2'-Acetylacetanilide;N-(2-Acetylphenyl)acetamide;N-(o-Acetylphenyl)acetamide;NSC 12469;o-Acetamidoacetophenone; | ||||||||||||||||||
| CAS: | 5234-26-4 | ||||||||||||||||||
| Molecular Formula: | C10H11NO2 | ||||||||||||||||||
| Molecular Weight: | 177.19984 | ||||||||||||||||||
| InChI: | InChI=1/C10H11NO2/c1-7(12)9-5-3-4-6-10(9)11-8(2)13/h3-6H,1-2H3,(H,11,13) | ||||||||||||||||||
| Molecular Structure: |  |
||||||||||||||||||
| Properties | |||||||||||||||||||
| Density: | 1.15 g/cm3 | ||||||||||||||||||
| Refractive index: | 1.57 | ||||||||||||||||||
| Specification: |
The N-(2-Acetylphenyl)acetamide, with the CAS registry number 5234-26-4, has the systematic name and IUPAC name of N-(2-acetylphenyl)acetamide. And the molecular formula of the chemical is C10H11NO2. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.50; (2)#ofRuleof5Violations: 0; (3)ACD/LogD(pH5.5): 1.5; (4)ACD/LogD(pH7.4): 1.5; (5)ACD/BCF(pH5.5): 8.12; (6)ACD/BCF(pH7.4): 8.12; (7)ACD/KOC(pH5.5): 155.79; (8)ACD/KOC(pH7.4): 155.79; (9)#Hbondacceptors: 3; (10)#Hbonddonors: 1; (11)#FreelyRotatingBonds: 2; (12)PolarSurfaceArea: 37.38 Å2; (13)IndexofRefraction: 1.57; (14)MolarRefractivity: 50.55cm3; (15)MolarVolume: 154cm3; (16)Polarizability: 20.04 ×10-24cm3; (17)SurfaceTension: 43.7dyne/cm; (18)Density: 1.15g/cm3; (19)FlashPoint: 165.1°C; (20)EnthalpyofVaporization: 61.39kJ/mol; (21)BoilingPoint: 367.4°Cat760mmHg; (22)VapourPressure: 1.37E-05mmHgat25°C. Addtionally, the following datas could be converted into the molecular structure: The toxicity data is as follows:
| ||||||||||||||||||
| Safety Data | |||||||||||||||||||
 |
|||||||||||||||||||
