| Identification | |
| Name: | Carboxin |
| Synonyms: | 1,4-Oxathiin-3-carboxanilide,5,6-dihydro-2-methyl- (7CI,8CI); 1-Oxa-2-methyl-3-(anilidocarbonyl)-4-thiacyclohex-2-ene;2,3-Dihydro-5-carboxanilido-6-methyl-1,4-oxathiin;2,3-Dihydro-6-methyl-1,4-oxathiin-5-carboxanilide;2,3-Dihydro-6-methyl-1,4-oxathiine-5-carboxylic acid anilide;5,6-Dihydro-2-methyl-1,4-oxathiin-3-carboxanilide; Carbathiin; Carboxin; Carboxine;D 735; DCMO; DMOC; F 735; Fenoxan; Karboxyn;N-Phenyl-2-methyl-5,6-dihydrooxathiin-3-carboxamide; NSC 263492; V 4X; Vitaflo250; Vitavax; Vitavax 100; Vitavax 735D; Vitavax 75W; Vitavax EC 200 |
| CAS: | 5234-68-4 |
| EINECS: | 226-031-1 |
| Molecular Formula: | C12H13 N O2 S |
| Molecular Weight: | 235.302 |
| InChI: | InChI=1S/C12H13NO2S/c1-9-11(16-8-7-15-9)12(14)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61894? |
| Boiling Point: | 420.6°C at 760 mmHg |
| Density: | 1.45 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.636 |
| Water Solubility: | 10.095 g/100 mL |
| Solubility: | 10.095 g/100 mL |
| Appearance: | Off-white crystals. Odorless. |
| Color: | CRYSTALS FROM ETHANOL OR METHANOL WHITE SOLID Off-white crystalline solid |
| Usage: | Carboxin is a systemic fungicide used for seed treatments of cereals against bunts & smuts & with other fungicides for the control of most other seed-borne and soil-borne seedling diseases, also against rhizoctonia species on cotton, groundnuts & vegetables. The dimorphic forms do not differ in fungicidal activity. |
| Safety Data | |
 |
|
