| Identification |
| Name: | Benzoic acid,2-hydrazinyl-, hydrochloride (1:1) |
| Synonyms: | Benzoicacid, 2-hydrazino-, monohydrochloride (9CI);2-Carboxyphenylhydrazinehydrochloride;2-Hydrazinobenzoic acid monohydrochloride;o-Hydrazinobenzoicacid hydrochloride;o-Hydrazinobenzoic acid monohydrochloride; |
| CAS: | 52356-01-1 |
| EINECS: | 257-869-6 |
| Molecular Formula: | C7H9ClN2O2 |
| Molecular Weight: | 188.61 |
| InChI: | InChI=1/C7H8N2O2.ClH/c8-9-6-4-2-1-3-5(6)7(10)11;/h1-4,9H,8H2,(H,10,11);1H |
| Molecular Structure: |
 |
| Properties |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to light yellow crystal powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
