| Identification |
| Name: | Borinic acid,B,B-diphenyl-, 2-aminoethyl ester |
| Synonyms: | Borinicacid, diphenyl-, 2-aminoethyl ester (6CI,7CI,8CI,9CI);Ethanol, 2-amino-,diphenylborinate (ester) (8CI);(2-Aminoethyloxy)diphenylborane;2-APB;2-Aminoethoxydiphenyl borate;2-Aminoethoxydiphenylborane;2-Aminoethyldiphenylborinate;B-(2-Aminoethoxy)diphenylborane;NSC 17107;NaturstoffreagenzA; |
| CAS: | 524-95-8 |
| EINECS: | 208-366-5 |
| Molecular Formula: | C14H16BNO |
| Molecular Weight: | 225.09 |
| InChI: | InChI=1/C14H16BNO/c16-11-12-17-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,16H2 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.04 g/cm3 |
| Refractive index: | 1.559 |
| Appearance: | white |
| Biological Activity: | A functional and membrane permeable D-myo-inositol 1,4,5-trisphosphate (IP 3 ) receptor antagonist (IC 50 = 42 μ M). Stimulates store-operated calcium (SOC) release at low concentrations (< 10 μ M) and inhibits it at higher concentrations (up to 50 μ M). Increases STIM-Orai channel conductance and limits ion selectivity. Modulator of TRP channels; blocks TRPC1, TRPC3, TRPC5, TRPC6, TRPV6, TRPM3, TRPM7, TRPM8 and TRPP2 and at higher concentrations stimulates TRPV1, TRPV2 and TRPV3. Also blocks specific gap channel subtypes. |
| Storage Temperature: | 2-8°C |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
