| Identification |
| Name: | Butanoic acid, 3-oxo-,dodecyl ester |
| Synonyms: | Acetoaceticacid, dodecyl ester (6CI); Dodecyl alcohol, acetoacetate (5CI); Dodecyl3-oxobutanoate; Dodecyl acetoacetate; Lauryl acetoacetate; n-Dodecylacetoacetate |
| CAS: | 52406-22-1 |
| EINECS: | 257-896-3 |
| Molecular Formula: | C16H30 O3 |
| Molecular Weight: | 270.4076 |
| InChI: | InChI=1/C16H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-19-16(18)14-15(2)17/h3-14H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 126.8°C |
| Boiling Point: | 309.2°Cat760mmHg |
| Density: | 0.922g/cm3 |
| Refractive index: | 1.444 |
| Flash Point: | 126.8°C |
| Usage: | Dodecyl acetoacetate is used as intermediate for the synthesis of organic chemicals. Product Data Sheet |
| Safety Data |
| |
 |
