| Identification | |
| Name: | 9-Acridinamine,hydrochloride, hydrate (1:1:1) |
| Synonyms: | 9-Acridinamine,monohydrochloride, monohydrate (9CI); 9-Aminoacridine hydrochloride monohydrate |
| CAS: | 52417-22-8 |
| EINECS: | 205-145-5 |
| Molecular Formula: | C13H10 N2 . Cl H . H2 O |
| Molecular Weight: | 248.70812 |
| InChI: | InChI=1S/C13H10N2.ClH.H2O/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;/h1-8H,(H2,14,15);1H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, acid anhydrides. |
| Water Solubility: | Slightly soluble in water |
| Solubility: | Slightly soluble in water |
| Appearance: | yellow powder |
| Specification: |
9-Acridamine, monohydrochloride, monohydrate , its cas register number is 52417-22-8. It also can be called 9-Aminoacridine hydrochloride, monohydrate ; CCRIS 6208 ; 9-Acridinamine, monohydrochloride, monohydrate ; 9-Aminoacridine hydrochloride hydrate .It is a bright yellow to yellow-green powder. It is sensitive to prolonged exposure to air and slightly soluble in water. Symptoms of exposure to 9-Acridamine, monohydrochloride, monohydrate (CAS NO.52417-22-8) include irritation of the gastrointestinal mucosa, nausea and vomiting. It is is probably combustible. |
| Packinggroup: | III |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
