| Identification | |
| Name: | Thiophene,2,5-dibromo-3,4-dinitro- |
| Synonyms: | 2,5-Dibromo-3,4-dinitrothiophene;NSC 84661 |
| CAS: | 52431-30-8 |
| EINECS: | -0 |
| Molecular Formula: | C4Br2 N2 O4 S |
| Molecular Weight: | 331.92 |
| InChI: | InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 137°C |
| Flash Point: | 160.2°C |
| Boiling Point: | 341.2°Cat760mmHg |
| Density: | 2.459g/cm3 |
| Refractive index: | 1.716 |
| Specification: |
2,5-Dibromo-3,4-dinitrothiophene with CAS number of 52431-30-8 is also called for 2,5-Dibromo-3,4-dinitrothiophene ; Akos 92299 ; 2,5-Dibromo-3,4-dinitrthiphene ; 2,5-Dibromo-3,4-dinitrothiophene 98+% . |
| Flash Point: | 160.2°C |
| Safety Data | |
 |
|
