| Identification | |
| Name: | Formaldehyde, polymer with 1,1-biphenyl-4-ol and 4-(1,1-dimethylethyl)phenol |
| Synonyms: | Formaldehyde, polymer with 1,1-biphenyl-4-ol and 4-(1,1-dimethylethyl)phenol;4-Phenylphenol, p-tert-butylphenol, formaldehyde polymer;4-Phenylphenol,p-tert-butylphenol,formaldehyde polymer;p-Phenylphenol, formaldehyde, p-tert-butylphenol polymer;p-Phenylphenol,formaldehyde,p-tert-butylphenol polymer;4-phenylphenol/ formaldehyde/ p-tert-butylphenol copolymer |
| CAS: | 52469-00-8 |
| Molecular Formula: | C23H26O3 |
| Molecular Weight: | 350.45074 |
| InChI: | InChI=1S/C12H10O.C10H14O.CH2O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-10(2,3)8-4-6-9(11)7-5-8;1-2/h1-9,13H;4-7,11H,1-3H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 147.2°C |
| Boiling Point: | 306.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 147.2°C |
| Safety Data | |
 |
|
