| Identification | |
| Name: | 2-Propanol,1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)- |
| CAS: | 525-66-6 |
| EINECS: | 208-378-0 |
| Molecular Formula: | C16H21 N O2 |
| Molecular Weight: | 259.38 |
| InChI: | InChI=1/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.093 g/cm3 |
| Stability: | It is stable to heat, unstable to light. |
| Water Solubility: | Sol of 1 in 20 of water or alcohol; sltly sol in chloroform; practically insol in ether. |
| Solubility: | Sol of 1 in 20 of water or alcohol; sltly sol in chloroform; practically insol in ether. |
| Appearance: | White, odorless crystalline powder. |
| Specification: |
Inderal (CAS NO.525-66-6),which also can be called for 1-Isopropylamino-3-(1-naphthyloxy)propan-2-ol ; Propranolol Base ; 1-[Isopropylamino]-3-[1-naphthyloxy]-2-propanol ; 2-Propanol,1-(1-methylethyl)amino-3-(1-naphthalenyloxy)- ; 1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol ; 1-(1-Naphthyloxy)-3-(isopropylamino)-2-propanol ; 2-Propanol,1-(isopropylamino)-3-(1-naphthyloxy)- (7CI,8CI) ; 2-Propanol,1-[(1-methylethyl)amino]-3-(1-naphthalenyloxy)- (9CI) .When Inderal (525-66-6) was heated,it emits toxic fumes of NOx .This chemical is a crystals from Cyclohexane and it's slightly soluble in water.It is stable to heat, unstable to light. |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Medication (vet). |
| Safety Data | |
| Hazard Symbols | |
 |
|
