| Identification | |
| Name: | 4-Methoxy-2(1H)-pyridinone |
| Synonyms: | 4-METHOXY-2(1H)-PYRIDINONE; |
| CAS: | 52545-13-8 |
| Molecular Formula: | C6H7NO2 |
| Molecular Weight: | 125.13 |
| InChI: | InChI=1/C6H7NO2/c1-9-5-2-3-7-6(8)4-5/h2-4H,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 168.5°C |
| Boiling Point: | 355.1°C at 760 mmHg |
| Density: | 1.16g/cm3 |
| Refractive index: | 1.526 |
| Specification: |
The 4-Methoxy-2(1H)-pyridinone with cas registry number of 52545-13-8, belongs to the following product categorie: pyridine. It is also called 4-METHOXY-2(1H)-PYRIDINONE; 4-Methoxy-2-pyridone4-METHOXY-2(1H)-PYRIDINONE. Physical properties about this chemical are: You can still convert the following datas into molecular structure:
|
| Flash Point: | 168.5°C |
| Safety Data | |
 |
|
