| Identification | |
| Name: | Phenol,2-[bis(2-hydroxyethyl)amino]-5-nitro- |
| Synonyms: | N,N-Bis(2-hydroxyethyl)-2-amino-5-nitrophenol;N,N-Bis(2'-hydroxyethyl)-2-amino-5-nitrophenol; |
| CAS: | 52551-67-4 |
| EINECS: | 258-002-4 |
| Molecular Formula: | C10H14 N2 O5 |
| Molecular Weight: | 242.26 |
| InChI: | InChI=1/C10H14N2O5/c13-5-3-11(4-6-14)9-2-1-8(12(16)17)7-10(9)15/h1-2,7,13-15H,3-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 232.4°C |
| Boiling Point: | 460.7°C at 760 mmHg |
| Density: | 1.461g/cm3 |
| Refractive index: | 1.662 |
| Specification: |
2-(Bis(2-hydroxyethyl)amino)-5-nitrophenol (CAS NO.52551-67-4) is a toxic substance, with a flammability; thermal decomposition of toxic fumes nitrogen oxides need to dry and ventilated environment of low-temperature storage; and the Treasury kept separate from food materials can be dealt with dry powder, foam, sand, carbon dioxide, water mist fire-extinguishing agents on the its processing. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 232.4°C |
| Safety Data | |
 |
|
