| Identification | |
| Name: | 1,2,3-Trimethylbenzene |
| Synonyms: | Trimethylbenzene; 90%; hemimellitene |
| CAS: | 526-73-8 |
| EINECS: | 208-394-8 |
| Molecular Formula: | C9H12 |
| Molecular Weight: | 120.19 |
| InChI: | InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3295 |
| Density: | 0.894 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.513 |
| Solubility: | Miscible with ethanol, ether, acetone, benzene, petroleum ether, carbon tetrachloride In water, 75.2 mg/L at 25 deg C |
| Appearance: | colourless liquid |
| Specification: |
1,2,3-Trimethylbenzene , its cas register number is 526-73-8. It also can be called Hemimellitene ; and Benzene, 1,2,3-trimethyl- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Color: | Colorless liquid Clear, colorless liquid |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
