| Identification | |
| Name: | Pyridine,2,3-dimethoxy- |
| Synonyms: | 2,3-Dimethoxypyridine |
| CAS: | 52605-97-7 |
| Molecular Formula: | C7H9NO2 |
| Molecular Weight: | 139.15 |
| InChI: | InChI=1/C7H9NO2/c1-9-6-4-3-5-8-7(6)10-2/h3-5H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 63.6°C |
| Boiling Point: | 179.8°Cat760mmHg |
| Density: | 1.064g/cm3 |
| Refractive index: | 1.5205 |
| Appearance: | Yellow Liquid |
| Specification: |
2,3-Dimethoxypyridine (52605-97-7) is a kind of pyridines derivates with appearance of yellow liquid. It is also called 2,3-DIMETHOXYPYRIDINE ; PYRIDINE, 2,3-DIMETHOXY- ; 2,3-Dimethoxypyridine ,98% . |
| Flash Point: | 63.6°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
 |
|
