| Identification | |
| Name: | Benzenamine,4-methyl-3-(1-methylethyl)- |
| Synonyms: | o-Cymen-4-amine(7CI,8CI);p-Toluidine, 3-isopropyl-; |
| CAS: | 5266-84-2 |
| Molecular Formula: | C10H15N |
| Molecular Weight: | 149.23 |
| InChI: | InChI=1/C10H15N/c1-7(2)10-6-9(11)5-4-8(10)3/h4-7H,11H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.944 g/cm3 |
| Refractive index: | 1.539 |
| Specification: |
The 4-Methyl-3-(1-methylethyl)benzenamine, with the CAS registry number 5266-84-2, has the systematic name of 4-methyl-3-(propan-2-yl)aniline. And the molecular formula of the chemical is C10H15N. The characteristics of this chemical are as followings: (1)ACD/LogP: 2.65; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 50; (6)ACD/BCF (pH 7.4): 70; (7)ACD/KOC (pH 5.5): 522; (8)ACD/KOC (pH 7.4): 729; (9)#H bond acceptors: 1; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 26.02 Å2; (13)Index of Refraction: 1.539; (14)Molar Refractivity: 49.499 cm3; (15)Molar Volume: 158.061 cm3; (16)Polarizability: 19.623×10-24cm3; (17)Surface Tension: 35.492 dyne/cm; (18)Density: 0.944 g/cm3; (19)Flash Point: 103.211 °C; (20)Enthalpy of Vaporization: 48.031 kJ/mol; (21)Boiling Point: 243.299 °C at 760 mmHg; (22)Vapour Pressure: 0.032 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
