| Identification |
| Name: | D-(+)-2-Amino-3-phenyl-1-propanol |
| Synonyms: | D-(+)-Phenylalaninol; (R)-(+)-2-amino-3-phenyl-1-propanol; D-2-Phenylalaninol; D-Phenylalaninol; H-D-Phe-ol; D-2-Phenylalanionl; |
| CAS: | 5267-64-1 |
| EINECS: | 226-086-1 |
| Molecular Formula: | C9H13NO |
| Molecular Weight: | 151.21 |
| InChI: | InChI=1/C9H13NO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-5,9,11H,6-7,10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3259 |
| Flash Point: | 137.5oC |
| Boiling Point: | 303.8oC at 760 mmHg |
| Density: | 1.077 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Alpha: | 23 o (C=1.2, 1 N HCL 22 oC) |
| Appearance: | white to light yellow crystal powde |
| Flash Point: | 137.5oC |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
