| Identification | |
| Name: | Benzene,1,2,3,5-tetramethyl- |
| Synonyms: | 1,2,3,5-Tetramethylbenzene;1,3,4,5-Tetramethylbenzene; Isodurene; NSC 8091 |
| CAS: | 527-53-7 |
| EINECS: | 208-417-1 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.24 |
| InChI: | InChI=1/C10H14/c1-7-5-8(2)10(4)9(3)6-7/h5-6H,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3082 |
| Flash Point: | 63°C |
| Boiling Point: | 198°C |
| Density: | 0,89 g/cm3 |
| Refractive index: | n20/D 1.512(lit.) |
| Specification: |
Vigorous reactions, sometimes amounting to explosions, can result from the contact between aromatic hydrocarbons, such as 1,2,3,5-Tetramethylbenzene, and strong oxidizing agents. They can react exothermically with bases and with diazo compounds. Substitution at the benzene nucleus occurs by halogenation (acid catalyst), nitration, sulfonation, and the Friedel-Crafts reaction. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 63°C |
| Safety Data | |
 |
|
