| Identification |
| Name: | Hexyl Glyoxylate |
| Synonyms: | Glyoxylsaeure-n-hexylester;Hexyl Glyoxylate;Oxo-acetic Acid Hexyl Este;Oxo-acetic Acid Hexyl Ester |
| CAS: | 52709-43-0 |
| Molecular Formula: | C8H14O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H14O3/c1-2-3-4-5-6-11-8(10)7-9/h7H,2-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 82.623°C |
| Boiling Point: | 213.8°C at 760 mmHg |
| Density: | 0.98g/cm3 |
| Refractive index: | 1.423 |
| Flash Point: | 82.623°C |
| Usage: | A glyoxylic ester, useful precursor in the synthesis of novel low molecular weight metalloporphyrins. |
| Safety Data |
| |
 |
