| Identification |
| Name: | 2-Thiophenecarbonyl chloride |
| Synonyms: | 2-(Chlorocarbonyl)thiophene;2-(Chloroformyl)thiophene;2-Thenoyl chloride;2-Thienylcarbonyl chloride;2-Thiophenecarboxylic acid chloride;2-Thiophenecarboxylic chloride;Thenoyl chloride;Thiophen-2-ylcarbonyl chloride;a-Thenoyl chloride; |
| CAS: | 5271-67-0 |
| EINECS: | 226-092-4 |
| Molecular Formula: | C5H3ClOS |
| Molecular Weight: | 146.59 |
| InChI: | InChI=1/C5H3ClOS/c6-5(7)4-2-1-3-8-4/h1-3H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.372 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | 1.589-1.591 |
| Water Solubility: | Decomposes SOLVENT |
| Solubility: | Decomposes SOLVENT |
| Appearance: | clear
to slightly yellowish crystals |
| Packinggroup: | II |
| HS Code: | 29349990 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
