| Identification | |
| Name: | 1,3-Benzenediol,4-[2-(2-pyridinyl)diazenyl]-, sodium salt (1:2) |
| Synonyms: | 1,3-Benzenediol,4-(2-pyridinylazo)-, disodium salt (9CI); 4-(2-Pyridylazo)resorcinol disodiumsalt |
| CAS: | 52722-53-9 |
| EINECS: | 258-131-6 |
| Molecular Formula: | C11H9 N3 O2 . 2 Na |
| Molecular Weight: | 259.17 |
| InChI: | InChI=1/C11H9N3O2/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11/h1-7,16H,(H,12,14)/b13-9+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 188 °C |
| Flash Point: | 218.8°C |
| Boiling Point: | 438.2°Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.652 |
| Specification: | red-brown to brown crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 218.8°C |
| Safety Data | |
 |
|
