| Identification | |
| Name: | PMA HYDROCHLORIDE |
| Synonyms: | (+-)-1-(4-methoxyphenyl)-2-aminopropanehydrochloride;4-methoxy-alpha-methyl-,hydrochloride,dl-phenethylamin;dl-4-methoxyamphetaminehydrochloride;dl-p-methoxy-alpha-methyl-phenethylaminehydrochloride;(+/-)-P-METHOXYAMPHETAMINE HYDROCHLORIDE;P-METHOXYAMPHETAMINE HYDROCHLORIDE;PMA HYDROCHLORIDE;(+-)-P-methoxyamphetamine hydrochloride --dea sch |
| CAS: | 52740-56-4 |
| Molecular Formula: | C10H16ClNO |
| Molecular Weight: | 201.69 |
| InChI: | InChI=1/C10H15NO.ClH/c1-8(11)7-9-3-5-10(12-2)6-4-9;/h3-6,8H,7,11H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Flash Point: | 11 °C |
| Boiling Point: | 258.2°C at 760 mmHg |
| Specification: | Safety Statements:36/37/39-45-36/37-16 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves 16:Keep away from sources of ignition - No smoking |
| Flash Point: | 11 °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
