| Identification | |
| Name: | Alanine,N-benzoyl-N-(3-chloro-4-fluorophenyl)-, methyl ester |
| Synonyms: | DL-Alanine,N-benzoyl-N-(3-chloro-4-fluorophenyl)-, methyl ester;DL-N-Benzoyl-N-(3-chloro-4-fluorophenyl)alanine methyl ester; Flamprop-methyl;Flufenprop-methyl; Mataven; Methyl2-[benzoyl(3-chloro-4-fluorophenyl)amino]propionate; Super-Suffix; WL 29761 |
| CAS: | 52756-25-9 |
| EINECS: | 258-155-7 |
| Molecular Formula: | C17H15 Cl F N O3 |
| Molecular Weight: | 335.78 |
| InChI: | InChI=1/C17H15ClFNO3/c1-11(17(22)23-2)20(13-8-9-15(19)14(18)10-13)16(21)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3077 9/PG 3 |
| Flash Point: | >100 °C |
| Boiling Point: | 459.5°C at 760 mmHg |
| Density: | 1.309g/cm3 |
| Refractive index: | 1.586 |
| Specification: | Safety Statements:61 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | >100 °C |
| Storage Temperature: | 0-6°C |
| Safety Data | |
 |
|
