| Identification | |
| Name: | Ethanone,1-(2,3,4-trihydroxyphenyl)- |
| Synonyms: | Acetophenone,2',3',4'-trihydroxy- (7CI,8CI); Gallacetophenone (6CI);1-(2,3,4-Trihydroxyphenyl)ethanone; 2',3',4'-Trihydroxyacetophenone;4-Acetylpyrogallol; Alizarin Yellow C; Alizarine Yellow C; C.I. 57000; NSC66553 |
| CAS: | 528-21-2 |
| EINECS: | 208-430-2 |
| Molecular Formula: | C8H8 O4 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.446 g/cm3 |
| Refractive index: | 1.64 |
| Water Solubility: | SOLUBLE IN ALCOHOL, ETHER AND SOLUTIONS OF SODIUM.Slightly soluble in water |
| Solubility: | SOLUBLE IN ALCOHOL, ETHER AND SOLUTIONS OF SODIUM.Slightly soluble in water |
| Appearance: | Yellow-green crystalline powder. |
| Specification: |
2,3,4-Trihydroxyacetophenone ,its CAS NO. is 528-21-2,the synonyms is Eugallol ; Gallacetophenone ; 2',3',4'-Trihydroxyacetophenone ; 2,3,4-Trihydroxyacetophenone ; Pyrogallol monoacetate ; 1-(2,3,4-Trihydroxyphenyl)-ethanon ; 1-(2,3,4-Trihydroxyphenyl)ethanone ; 2',3',4'-Trihydroxy-acetophenon . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
