| Identification | |
| Name: | 1,2-Dinitrobenzene |
| Synonyms: | - |
| CAS: | 528-29-0 |
| EINECS: | 208-431-8 |
| Molecular Formula: | C6H4N2O4 |
| Molecular Weight: | 168.11 |
| InChI: | InChI=1/C6H4N2O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3443 |
| Density: | 1.31 g/cm3 (20 C) |
| Stability: | Highly reactive. |
| Refractive index: | 1.565 (17 C) |
| Solubility: | 150 mg/L (20 ºC) |
| Appearance: | Colorless to yellow solid. |
| Packinggroup: | II |
| HS Code: | 29042000 |
| Storage Temperature: | Store at only in permanent magazine. Keep away from initiator explosives and protected from physical damage - separated from oxidizing materials and source of heat. |
| Color: | COLORLESS OR YELLOW CRYSTALS, NEEDLES OR PLATES White to yellow monoclinic plates White crystals Pale white or yellow, crystalline solid. |
| Usage: | Used for the synthesis of dyestuffs, dyestuff intermediates, explosives, and celluloid production. |
| Safety Data | |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
 |
|
