| Identification |
| Name: | 4H-1-Benzopyran-4-one,2-(3,4-dihydroxyphenyl)-3,7-dihydroxy- |
| Synonyms: | Fisetin(6CI);Flavone, 3,3',4',7-tetrahydroxy- (8CI);2-(3,4-Dihydroxyphenyl)-3,7-dihydroxy-4H-benzopyran-4-one;3,3',4',7-Tetrahydroxyflavone;5-Desoxyquercetin;Bois Bleu de Honqrie;C.I.75620;C.I. Natural Brown 1;Cotinin;Fisetholz;Fustel;Fustet;Junger Fustik;NSC 407010;NSC 656275;Superfustel;Superfustel K;Ungarisches Gelbholz;Ventin Sumach;Viset;Young Fustic;Young FusticCrystals;Zante Fustic; |
| CAS: | 528-48-3 |
| EINECS: | 208-434-4 |
| Molecular Formula: | C15H10O6 |
| Molecular Weight: | 286.24 |
| InChI: | InChI=1/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 233°C |
| Boiling Point: | 599.4°Cat760mmHg |
| Density: | 1.688g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.784 |
| Solubility: | |
| Appearance: | yellow to brown crystalline powder |
| Flash Point: | 233°C |
| Storage Temperature: | −20°C |
| Usage: | Antioxidant, trolox equivalent: 5.6 Mm. |
| Safety Data |
| |
 |
