| Identification |
| Name: | D-Glucose, 4-O-b-D-glucopyranosyl- |
| Synonyms: | D-Glucose, 4-O-beta-D-glucopyranosyl-;4-O-b-D-Glucopyranosyl-D-glucose;4-b-D-Glucopyranosyl-D-glucopyranose;Cellose;D-Cellobiose; |
| CAS: | 528-50-7 |
| EINECS: | 208-436-5 |
| Molecular Formula: | C12H22O11 |
| Molecular Weight: | 342.30 |
| InChI: | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11-,12+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 239 ºC |
| Flash Point: | 357.8°C |
| Boiling Point: | 667.9°Cat760mmHg |
| Density: | 1.76g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 34 ° (C=8, H2O) |
| Alpha: | 34 º (C=1, H2O,15 HRS.) |
| Water Solubility: | moderate Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Believed to be of low toxicity. Toxicity data (The meaning of any to |
| Solubility: | moderate |
| Appearance: | white powder |
| HS Code: | 29400090 |
| Flash Point: | 357.8°C |
| Storage Temperature: | Store at RT. |
| Safety Data |
| |
 |
