| Identification | |
| Name: | Benzoic acid,4-(butylamino)-2-hydroxy-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) |
| Synonyms: | Benzoicacid, 4-(butylamino)-2-hydroxy-, 2-(diethylamino)ethyl ester, monohydrochloride(9CI); Ethanol, 2-diethylamino-, 4-butylaminosalicylate, hydrochloride (6CI);Salicylic acid, 4-(butylamino)-, 2-(diethylamino)ethyl ester, monohydrochloride(8CI); Bronchiocain; Bronchocain; Bronchocaine; Paraesin; S 650; Wofacain A;p-Butylaminosalicylic acid diethylaminoethyl ester hydrochloride |
| CAS: | 528-97-2 |
| EINECS: | 208-447-5 |
| Molecular Formula: | C17H28 N2 O3 . Cl H |
| Molecular Weight: | 344.93 |
| InChI: | InChI=1/C17H28N2O3.ClH/c1-4-7-10-18-14-8-9-16(20)15(13-14)17(21)22-12-11-19(5-2)6-3;/h8-9,13,18,20H,4-7,10-12H2,1-3H3;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 220.5°C |
| Boiling Point: | 440.9°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Bronchocain , its cas register number is 528-97-2. It also can be called 4-(Butylamino)salicylic acid 2-(diethylamino)ethyl ester hydrochloride ; Bronchocaine ; and 2-(Diethylamino)ethyl 4-(butylamino)salicylate monohydrochloride . |
| Flash Point: | 220.5°C |
| Safety Data | |
 |
|
