| Identification | |
| Name: | Benzaldehyde, 2-amino- |
| Synonyms: | Anthranilaldehyde(6CI,7CI,8CI);2-Formylaniline;o-Aminobenzaldehyde; |
| CAS: | 529-23-7 |
| EINECS: | 208-454-3 |
| Molecular Formula: | C7H7NO |
| Molecular Weight: | 121.14 |
| InChI: | InChI=1/C7H7NO/c8-7-4-2-1-3-6(7)5-9/h1-5H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 110.2 ºC |
| Boiling Point: | 258.7ºC at 760 mmHg |
| Density: | 1.171 g/cm3 |
| Stability: | Unstable: reported to polymerize rapidly at room temperature. Incompatible with strong oxidizing agents, strong bases. Store at -20 C. |
| Refractive index: | 1.639 |
| Solubility: |
|
| Appearance: | light yellow crystalline powder |
| Flash Point: | 110.2 ºC |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
