| Identification | |
| Name: | 1-Naphthalenethiol |
| CAS: | 529-36-2 |
| EINECS: | 208-462-7 |
| Molecular Formula: | C10H8S |
| Molecular Weight: | 160.237 |
| InChI: | InChI=1S/C10H8S/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Flash Point: | 134.2°C |
| Boiling Point: | 131 °C (5 mmHg) |
| Density: | 1.15 |
| Refractive index: | 1.679-1.681 |
| Appearance: | clear light yellow to yellow liquid |
| Specification: | clear light yellow to yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 134.2°C |
| Safety Data | |
 |
|
