Identification |
Name: | 1-Naphthalenethiol |
CAS: | 529-36-2 |
EINECS: | 208-462-7 |
Molecular Formula: | C10H8S |
Molecular Weight: | 160.237 |
InChI: | InChI=1S/C10H8S/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
Molecular Structure: |
 |
Properties |
Transport: | UN 3082 9/PG 3 |
Flash Point: | 134.2°C |
Boiling Point: | 131 °C (5 mmHg) |
Density: | 1.15 |
Refractive index: | 1.679-1.681 |
Appearance: | clear light yellow to yellow liquid |
Specification: | clear light yellow to yellow liquid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 134.2°C |
Safety Data |
|
 |