| Identification | |
| Name: | Acetamide,N-ethyl-N-phenyl- |
| Synonyms: | Acetanilide,N-ethyl- (6CI,7CI,8CI); Acetethylanilide; Ethylacetanilide; Mannol;N-Ethylacetanilide; NSC 8737 |
| CAS: | 529-65-7 |
| EINECS: | 208-466-9 |
| Molecular Formula: | C10H13 N O |
| Molecular Weight: | 163.24 |
| InChI: | InChI=1/C10H13NO/c1-3-11(9(2)12)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101.4°C |
| Boiling Point: | 245.4°C at 760 mmHg |
| Density: | 1.035g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
Acetyl-n-ethylanilide with CAS number of 529-65-7 is also called for 4-12-00-00379 (Beilstein Handbook Reference) ; AI3-05523 ; Acetethylanilide ; BRN 2208178 ; EINECS 208-466-9 ; Ethylacetanilide ; Mannol ; N-Ethyl-N-phenylacetamide ; N-Ethylacetanilide ; NSC 8737 . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 101.4°C |
| Safety Data | |
 |
|
