Identification |
Name: | 2H-1-Benzopyran-2-one,6,7-dihydroxy-4-methyl- |
Synonyms: | Coumarin,6,7-dihydroxy-4-methyl- (7CI,8CI); Esculetin, 4-methyl- (6CI);4-Methyl-6,7-dihydroxycoumarin; 4-Methylaesculetin; 4-Methylesculetin;4-Methylesculetol; 6,7-Dihydroxy-4-methylcoumarin; Methylesculetin; NSC 11828;NSC 688807 |
CAS: | 529-84-0 |
EINECS: | 208-470-0 |
Molecular Formula: | C10H8 O4 |
Molecular Weight: | 192.16812 |
InChI: | InChI=1S/C10H8O4/c1-5-2-10(13)14-9-4-8(12)7(11)3-6(5)9/h2-4,11-12H,1H3 |
Molecular Structure: |
|
Properties |
Density: | 1.456 g/cm3 |
Refractive index: | 1.651 |
Water Solubility: | DMF: soluble in water |
Solubility: | DMF: soluble in water |
Appearance: | Yellow needle crystal |
Specification: | GREY POWDER Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
|