Identification |
Name: | 1H-Naphtho[2,3-c]pyran-3-aceticacid, 3,4,5,10-tetrahydro-9-hydroxy-1-methyl-5,10-dioxo-, (1S,3R)- |
Synonyms: | 1H-Naphtho[2,3-c]pyran-3-aceticacid, 3,4,5,10-tetrahydro-9-hydroxy-1-methyl-5,10-dioxo-, (1S-trans)-;Antibiotic OS 3966A; Nanafrocin; Nanaomycin A |
CAS: | 52934-83-5 |
Molecular Formula: | C16H14 O6 |
Molecular Weight: | 302.30 |
InChI: | InChI=1/C16H14O6/c1-7-13-10(5-8(22-7)6-12(18)19)15(20)9-3-2-4-11(17)14(9)16(13)21/h2-4,7-8,17H,5-6H2,1H3,(H,18,19)/t7-,8+/m0/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6.1/PG 3 |
Flash Point: | 229°C |
Boiling Point: | 601.5°Cat760mmHg |
Density: | 1.49g/cm3 |
Refractive index: | 1.648 |
Specification: | Safety Statements:36/37-45 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 229°C |
Storage Temperature: | −20°C |
Safety Data |
|
|