| Identification | |
| Name: | Benz[a]acridine,8,10-dimethyl- |
| Synonyms: | 5,7-Dimethyl-1,2-benzacridine;8,10-Dimethylbenz[a]acridine |
| CAS: | 53-69-0 |
| EINECS: | 200-180-2 |
| Molecular Formula: | C19H15 N |
| Molecular Weight: | 257.35 |
| InChI: | InChI=1/C19H15N/c1-12-9-13(2)19-15(10-12)11-17-16-6-4-3-5-14(16)7-8-18(17)20-19/h3-11H,1-2H3 |
| Molecular Structure: | ![(C19H15N) 5,7-Dimethyl-1,2-benzacridine;8,10-Dimethylbenz[a]acridine](https://img1.guidechem.com/chem/e/dict/47/53-69-0.jpg) |
| Properties | |
| Flash Point: | 209.5°C |
| Boiling Point: | 469.5°Cat760mmHg |
| Density: | 1.182g/cm3 |
| Refractive index: | 1.737 |
| Specification: |
5,7-Dimethyl-1,2-benzacridine , its cas register number is 53-69-0. It also can be called , 5-20-08-00537 (Beilstein Handbook Reference) ; 8,10-Dimethylbenz(a)acridine ; BRN 0180496 ; EINECS 200-180-2 . When 5,7-Dimethyl-1,2-benzacridine (CAS NO.53-69-0) is heated to decomposition, it emits toxic fumes of NOx. |
| Flash Point: | 209.5°C |
| Safety Data | |
 |
|
