| Identification | |
| Name: | 2-Chloro-5-methyl-1,4-phenylenediamine |
| Synonyms: | Toluene-2,5-diamine,4-chloro- (7CI,8CI);1,4-Diamino-2-methyl-5-chlorobenzene;2,5-Diamino-4-chlorotoluene;2-Chloro-5-methyl-p-phenylenediamine;2-Methyl-5-chloro-1,4-diaminobenzene;5-Chloro-2-methyl-1,4-phenylenediamine; |
| CAS: | 5307-03-9 |
| EINECS: | 226-162-4 |
| Molecular Formula: | C7H9ClN2 |
| Molecular Weight: | 156.61300 |
| InChI: | InChI=1/C7H9ClN2/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,9-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.281g/cm3 |
| Refractive index: | 1.647 |
| Appearance: | light brown powder |
| Specification: |
1,4-Benzenediamine,2-chloro-5-methyl- , its cas register number is 5307-03-9. It also can be called 2,5-Diamino-4-chlorotoluene ; 2-Chloro-5-methylbenzene-1,4-diamine . 1,4-Benzenediamine,2-chloro-5-methyl- (CAS NO.5307-03-9) is irritating to eyes, respiratory system and skin. |
| HS Code: | 2921519090 |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
