| Identification | |
| Name: | Piperazine,1-(2-methylpropyl)- |
| Synonyms: | Piperazine,1-isobutyl- (6CI,7CI,8CI);1-Isobutylpiperazine;Isobutylpiperazine; |
| CAS: | 5308-28-1 |
| Molecular Formula: | C8H18N2 |
| Molecular Weight: | 142.24 |
| InChI: | InChI=1/C8H18N2/c1-8(2)7-10-5-3-9-4-6-10/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.864 g/cm3 |
| Refractive index: | 1.446 |
| Appearance: | colorless to pale yellow liquid |
| Specification: |
N-Isobutyl piperazine , with CAS number of 5308-28-1, can be called 1-(2-methylpropyl)piperazine ; piperazine, 1-(2-methylpropyl)- ; 1-(2-Methylpropyl)-piperazine, 1-Isobutyl-piperazine . |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
