Identification |
Name: | Benzene,1-bromo-3-(phenylmethoxy)- |
Synonyms: | Ether,benzyl m-bromophenyl (7CI); 1-Benzyloxy-3-bromobenzene;1-Bromo-3-[(phenylmethyl)oxy]benzene; 1-Bromo-3-benzyloxybenzene;3-(Benzyloxy)-1-bromobenzene; 3-Benzyloxybromobenzene; 3-Bromophenyl benzylether; 3-Bromophenyl phenylmethyl ether; Benzyl 3-bromophenyl ether |
CAS: | 53087-13-1 |
Molecular Formula: | C13H11 Br O |
Molecular Weight: | 263.13 |
InChI: | InChI=1/C13H11BrO/c14-12-7-4-8-13(9-12)15-10-11-5-2-1-3-6-11/h1-9H,10H2 |
Molecular Structure: |
|
Properties |
Transport: | UN 3077 |
Melting Point: | 57-60 oC |
Density: | 1.382g/cm3 |
Refractive index: | 1.599 |
Appearance: | White to light yellow crystal powder |
Safety Data |
Hazard Symbols |
Xi: Irritant
N: Dangerous for the environment
|
|
|