| Identification | |
| Name: | 1-Pyrenol |
| Synonyms: | 1-Hydroxypyrene;3-Hydroxypyrene; 3-Pyrenol; NSC 30968 |
| CAS: | 5315-79-7 |
| Molecular Formula: | C16H10 O |
| Molecular Weight: | 218.25 |
| InChI: | InChI=1/C16H10O/c17-14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,17H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 179-182 °C(lit.) |
| Flash Point: | 213°C |
| Boiling Point: | 437.4°Cat760mmHg |
| Density: | 1.36g/cm3 |
| Stability: | May be Light Sensitive |
| Refractive index: | 1.895 |
| Appearance: | Pale Yellow Solid |
| Specification: | Pale Yellow Solid usageEng:Found in humane urine after exposure to coal tar and a coal derived product Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 213°C |
| Storage Temperature: | Refrigerator |
| Usage: | Found in humane urine after exposure to coal tar and a coal derived product |
| Safety Data | |
 |
|
