| Identification |
| Name: | Tropinone |
| Synonyms: | 3-Tropanone; 8-Methyl-8-azabicyclo[3.2.1]octan-3-one; |
| CAS: | 532-24-1 |
| EINECS: | 208-530-6 |
| Molecular Formula: | C8H13NO |
| Molecular Weight: | 139.2 |
| InChI: | InChI=1/C8H13NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-7H,2-5H2,1H3 |
| Molecular Structure: |
![(C8H13NO) 3-Tropanone; 8-Methyl-8-azabicyclo[3.2.1]octan-3-one;](https://img.guidechem.com/casimg/532-24-1.gif) |
| Properties |
| Transport: | 1544 |
| Density: | 66 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4598 (100 C) |
| Solubility: | Very soluble |
| Appearance: | Beige to brown crystalline powder. |
| Packinggroup: | III |
| HS Code: | 29399990 |
| Color: | brown |
| Usage: | Alkaloid. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
