| Identification | |
| Name: | Mandelonitrile |
| Synonyms: | alpha-Hydroxyphenylacetonitrile; Benzaldehyde cyanohydrin~alpha-Hydroxyphenylacetonitrile; Benzaldehydcyanhydrin |
| CAS: | 532-28-5 |
| EINECS: | 208-532-7 |
| Molecular Formula: | C8H7NO |
| Molecular Weight: | 133.15 |
| InChI: | InChI=1/C8H7NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 |
| Density: | 1.117 |
| Stability: | Stable, but moisture sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.5305-1.5335 |
| Water Solubility: | Decomposes SOLVENT |
| Solubility: | Decomposes SOLVENT |
| Appearance: | yellow to brown liquid |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
