| Identification | |
| Name: | Benzoyl isothiocyanate |
| Synonyms: | Benzoicacid, anhydride with isothiocyanic acid (6CI,7CI,8CI); Isothiocyanic acid,anhydride with benzoic acid (8CI); Benzoylthiocarbimide; N-Benzoylisothiocyanate; NSC 29259 |
| CAS: | 532-55-8 |
| EINECS: | 208-540-0 |
| Molecular Formula: | C8H5NOS |
| Molecular Weight: | 163.19 |
| InChI: | InChI=1/C8H5NOS/c10-8(9-6-11)7-4-2-1-3-5-7/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2810 |
| Melting Point: | 128 °C |
| Flash Point: | 106°C |
| Density: | 1.214 |
| Stability: | No data. |
| Refractive index: | 1.635-1.637 |
| Water Solubility: | almost insoluble |
| Solubility: | almost insoluble |
| Appearance: | Yellow or orange liquid. |
| Packinggroup: | III |
| HS Code: | 29309070 |
| Flash Point: | 106°C |
| Storage Temperature: | Keep Cold |
| Sensitive: | Moisture Sensitive/Lachrymatory |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
