| Identification | |
| Name: | 1-(2-Phenylethyl)piperazine |
| Synonyms: | 1-(Phenethyl)piperazine; 1-phenylethyl piperazine; |
| CAS: | 5321-49-3 |
| EINECS: | 226-186-5 |
| Molecular Formula: | C12H18N2 |
| Molecular Weight: | 190.28 |
| InChI: | InChI=1/C12H18N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h1-5,13H,6-11H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 8 |
| Refractive index: | n20/D 1.5430(lit.) |
| Specification: |
Piperazine,1-(2-phenylethyl)- , with CAS number of 5321-49-3, can be called 1-(2-Phenylethyl)piperazine ; 1-(2-Phenylethyl)piperazine 98% ; 1-phenethylpiperazine . |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xn: Harmful
|
 |
|
