| Identification | |
| Name: | 2-Hydroxy-5-(1H-pyrrol-1-yl)benzoic acid |
| Synonyms: | 2-HYDROXY-5-(1 H-PYRROL-1-YL)BENZOIC ACID |
| CAS: | 53242-70-9 |
| Molecular Formula: | C11H9NO3 |
| Molecular Weight: | 203.19 |
| InChI: | InChI=1/C11H9NO3/c13-10-4-3-8(7-9(10)11(14)15)12-5-1-2-6-12/h1-7,13H,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 200.3°C |
| Boiling Point: | 407.5°C at 760 mmHg |
| Density: | 1.3g/cm3 |
| Refractive index: | 1.621 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 200.3°C |
| Safety Data | |
 |
|
