| Identification | |
| Name: | 6-Chloronicotinic acid |
| Synonyms: | 6-Chloro-3-pyridinecarboxylic acid;6-chloropyridine-3-carboxylate;6-chloropyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 6-chloro-;6-Cholre Nicotinic Acid;6-Chloro nicotinic acid; |
| CAS: | 5326-23-8 |
| EINECS: | 226-201-5 |
| Molecular Formula: | C6H4ClNO2 |
| Molecular Weight: | 157.56 |
| InChI: | InChI=1/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 153.4oC |
| Boiling Point: | 330.1oC at 760 mmHg |
| Density: | 0.5 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Slightly soluble |
| Solubility: | Slightly soluble |
| Appearance: | off-white to yellow powder |
| Report: |
?6-Chloronicotinic acid (CAS NO.5326-23-8) is reported in EPA TSCA Inventory. |
| HS Code: | 29333999 |
| Flash Point: | 153.4oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | 6-Chloronicotinic acid (CAS NO.5326-23-8) is used as building block for different chemical synthesis. Product Data Sheet. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
